C16H10Cl2N4O2S — CID 168543235
N-(3,5-dichlorophenyl)-4-(2,2-dicyanoethenylamino)benzenesulfonamide (PubChem CID 168543235) has the molecular formula C16H10Cl2N4O2S and a molecular weight of 393.26 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-(2,2-dicyanoethenylamino)benzenesulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-(2,2-dicyanoethenylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 168543235 |
| Molecular Formula | C16H10Cl2N4O2S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-(2,2-dicyanoethenylamino)benzenesulfonamide |
| SMILES | N#CC(C#N)=CNc1ccc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H10Cl2N4O2S/c17-12-5-13(18)7-15(6-12)22-25(23,24)16-3-1-14(2-4-16)21-10-11(8-19)9-20/h1-7,10,21-22H |
| InChIKey | YZABKNUGOYNRNY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|