C14H11Cl2NO4S — CID 24509913
methyl 4-[(3,5-dichlorophenyl)sulfamoyl]benzoate (PubChem CID 24509913) has the molecular formula C14H11Cl2NO4S and a molecular weight of 360.22 g/mol. Its IUPAC name is methyl 4-[(3,5-dichlorophenyl)sulfamoyl]benzoate.
| Compound Name | methyl 4-[(3,5-dichlorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 24509913 |
| Molecular Formula | C14H11Cl2NO4S |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | methyl 4-[(3,5-dichlorophenyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C14H11Cl2NO4S/c1-21-14(18)9-2-4-13(5-3-9)22(19,20)17-12-7-10(15)6-11(16)8-12/h2-8,17H,1H3 |
| InChIKey | VUBBUXZUCVMJSD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |