C22H19ClN2O5S — CID 92681606
methyl 4-[[2-chloro-5-[(4-methylphenyl)sulfonylamino]benzoyl]amino]benzoate (PubChem CID 92681606) has the molecular formula C22H19ClN2O5S and a molecular weight of 458.92 g/mol. Its IUPAC name is methyl 4-[[2-chloro-5-[(4-methylphenyl)sulfonylamino]benzoyl]amino]benzoate.
| Compound Name | methyl 4-[[2-chloro-5-[(4-methylphenyl)sulfonylamino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 92681606 |
| Molecular Formula | C22H19ClN2O5S |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | methyl 4-[[2-chloro-5-[(4-methylphenyl)sulfonylamino]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc(NS(=O)(=O)c3ccc(C)cc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H19ClN2O5S/c1-14-3-10-18(11-4-14)31(28,29)25-17-9-12-20(23)19(13-17)21(26)24-16-7-5-15(6-8-16)22(27)30-2/h3-13,25H,1-2H3,(H,24,26) |
| InChIKey | AIWIFLPOVLQFCY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |