C21H16ClFN2O5S — CID 43000828
methyl 4-[[4-[(3-chloro-4-fluorophenyl)sulfonylamino]benzoyl]amino]benzoate (PubChem CID 43000828) has the molecular formula C21H16ClFN2O5S and a molecular weight of 462.89 g/mol. Its IUPAC name is methyl 4-[[4-[(3-chloro-4-fluorophenyl)sulfonylamino]benzoyl]amino]benzoate.
| Compound Name | methyl 4-[[4-[(3-chloro-4-fluorophenyl)sulfonylamino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 43000828 |
| Molecular Formula | C21H16ClFN2O5S |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | methyl 4-[[4-[(3-chloro-4-fluorophenyl)sulfonylamino]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(NS(=O)(=O)c3ccc(F)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C21H16ClFN2O5S/c1-30-21(27)14-4-6-15(7-5-14)24-20(26)13-2-8-16(9-3-13)25-31(28,29)17-10-11-19(23)18(22)12-17/h2-12,25H,1H3,(H,24,26) |
| InChIKey | JGBNRZPFBBRFEF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |