C19H12Cl2F2N2O3S — CID 26696432
N-(4-chloro-2-fluorophenyl)-4-[(3-chloro-4-fluorophenyl)sulfonylamino]benzamide (PubChem CID 26696432) has the molecular formula C19H12Cl2F2N2O3S and a molecular weight of 457.29 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-4-[(3-chloro-4-fluorophenyl)sulfonylamino]benzamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-4-[(3-chloro-4-fluorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 26696432 |
| Molecular Formula | C19H12Cl2F2N2O3S |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-4-[(3-chloro-4-fluorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H12Cl2F2N2O3S/c20-12-3-8-18(17(23)9-12)24-19(26)11-1-4-13(5-2-11)25-29(27,28)14-6-7-16(22)15(21)10-14/h1-10,25H,(H,24,26) |
| InChIKey | MVFNCSDVTCCKNO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |