C20H14Cl2FN3O4S — CID 18893156
N-[4-[(4-carbamoylphenyl)sulfamoyl]-2-fluorophenyl]-2,4-dichlorobenzamide (PubChem CID 18893156) has the molecular formula C20H14Cl2FN3O4S and a molecular weight of 482.32 g/mol. Its IUPAC name is N-[4-[(4-carbamoylphenyl)sulfamoyl]-2-fluorophenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-[(4-carbamoylphenyl)sulfamoyl]-2-fluorophenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 18893156 |
| Molecular Formula | C20H14Cl2FN3O4S |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | N-[4-[(4-carbamoylphenyl)sulfamoyl]-2-fluorophenyl]-2,4-dichlorobenzamide |
| SMILES | NC(=O)c1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(Cl)cc3Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C20H14Cl2FN3O4S/c21-12-3-7-15(16(22)9-12)20(28)25-18-8-6-14(10-17(18)23)31(29,30)26-13-4-1-11(2-5-13)19(24)27/h1-10,26H,(H2,24,27)(H,25,28) |
| InChIKey | AJZOSGPRVHIAEK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |