C16H15Cl2FN2O4S — CID 18893075
2,4-dichloro-N-[2-fluoro-4-(2-methoxyethylsulfamoyl)phenyl]benzamide (PubChem CID 18893075) has the molecular formula C16H15Cl2FN2O4S and a molecular weight of 421.28 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-fluoro-4-(2-methoxyethylsulfamoyl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-fluoro-4-(2-methoxyethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 18893075 |
| Molecular Formula | C16H15Cl2FN2O4S |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 2,4-dichloro-N-[2-fluoro-4-(2-methoxyethylsulfamoyl)phenyl]benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C16H15Cl2FN2O4S/c1-25-7-6-20-26(23,24)11-3-5-15(14(19)9-11)21-16(22)12-4-2-10(17)8-13(12)18/h2-5,8-9,20H,6-7H2,1H3,(H,21,22) |
| InChIKey | RDXZXOZNYNWLAT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|