C21H17Cl2FN2O5S — CID 18893144
2,4-dichloro-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]-2-fluorophenyl]benzamide (PubChem CID 18893144) has the molecular formula C21H17Cl2FN2O5S and a molecular weight of 499.35 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]-2-fluorophenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]-2-fluorophenyl]benzamide |
|---|---|
| PubChem CID | 18893144 |
| Molecular Formula | C21H17Cl2FN2O5S |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | 2,4-dichloro-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]-2-fluorophenyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(Cl)cc3Cl)c(F)c2)c(OC)c1 |
| InChI | InChI=1S/C21H17Cl2FN2O5S/c1-30-13-4-7-19(20(10-13)31-2)26-32(28,29)14-5-8-18(17(24)11-14)25-21(27)15-6-3-12(22)9-16(15)23/h3-11,26H,1-2H3,(H,25,27) |
| InChIKey | LSPFFUPYLLCVST-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |