C21H17Cl2FN2O3S — CID 18893102
2,4-dichloro-N-[4-[(3,5-dimethylphenyl)sulfamoyl]-2-fluorophenyl]benzamide (PubChem CID 18893102) has the molecular formula C21H17Cl2FN2O3S and a molecular weight of 467.35 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[(3,5-dimethylphenyl)sulfamoyl]-2-fluorophenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[(3,5-dimethylphenyl)sulfamoyl]-2-fluorophenyl]benzamide |
|---|---|
| PubChem CID | 18893102 |
| Molecular Formula | C21H17Cl2FN2O3S |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 2,4-dichloro-N-[4-[(3,5-dimethylphenyl)sulfamoyl]-2-fluorophenyl]benzamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(Cl)cc3Cl)c(F)c2)c1 |
| InChI | InChI=1S/C21H17Cl2FN2O3S/c1-12-7-13(2)9-15(8-12)26-30(28,29)16-4-6-20(19(24)11-16)25-21(27)17-5-3-14(22)10-18(17)23/h3-11,26H,1-2H3,(H,25,27) |
| InChIKey | HHEQOBYUKGKKFT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |