C19H10Cl5FN2O3S — CID 18893127
2,4-dichloro-N-[2-fluoro-4-[(2,4,5-trichlorophenyl)sulfamoyl]phenyl]benzamide (PubChem CID 18893127) has the molecular formula C19H10Cl5FN2O3S and a molecular weight of 542.63 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-fluoro-4-[(2,4,5-trichlorophenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-fluoro-4-[(2,4,5-trichlorophenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 18893127 |
| Molecular Formula | C19H10Cl5FN2O3S |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 539.88 |
| IUPAC Name | 2,4-dichloro-N-[2-fluoro-4-[(2,4,5-trichlorophenyl)sulfamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H10Cl5FN2O3S/c20-9-1-3-11(12(21)5-9)19(28)26-17-4-2-10(6-16(17)25)31(29,30)27-18-8-14(23)13(22)7-15(18)24/h1-8,27H,(H,26,28) |
| InChIKey | YYFBNJLXEZQIDQ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|