C25H18ClFN2O3S2 — CID 18893032
2-chloro-N-[2-fluoro-4-[(2-phenylsulfanylphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 18893032) has the molecular formula C25H18ClFN2O3S2 and a molecular weight of 513.02 g/mol. Its IUPAC name is 2-chloro-N-[2-fluoro-4-[(2-phenylsulfanylphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[2-fluoro-4-[(2-phenylsulfanylphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 18893032 |
| Molecular Formula | C25H18ClFN2O3S2 |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 2-chloro-N-[2-fluoro-4-[(2-phenylsulfanylphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccccc2Sc2ccccc2)cc1F)c1ccccc1Cl |
| InChI | InChI=1S/C25H18ClFN2O3S2/c26-20-11-5-4-10-19(20)25(30)28-22-15-14-18(16-21(22)27)34(31,32)29-23-12-6-7-13-24(23)33-17-8-2-1-3-9-17/h1-16,29H,(H,28,30) |
| InChIKey | PYJGDTJLQKZFDD-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |