C27H24ClN3O7S2 — CID 43885917
4-(benzenesulfonamido)-2-chloro-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 43885917) has the molecular formula C27H24ClN3O7S2 and a molecular weight of 602.09 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-2-chloro-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-2-chloro-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 43885917 |
| Molecular Formula | C27H24ClN3O7S2 |
| Molecular Weight | 602.09 g/mol |
| Exact Mass | 601.07 |
| IUPAC Name | 4-(benzenesulfonamido)-2-chloro-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(NS(=O)(=O)c4ccccc4)cc3Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H24ClN3O7S2/c1-37-20-11-15-25(26(17-20)38-2)31-40(35,36)22-12-8-18(9-13-22)29-27(32)23-14-10-19(16-24(23)28)30-39(33,34)21-6-4-3-5-7-21/h3-17,30-31H,1-2H3,(H,29,32) |
| InChIKey | URXPCNTYYGDREV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.09 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |