C21H19ClN2O3 — CID 112987942
2-chloro-N-[4-(2,4-dimethoxyanilino)phenyl]benzamide (PubChem CID 112987942) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is 2-chloro-N-[4-(2,4-dimethoxyanilino)phenyl]benzamide.
| Compound Name | 2-chloro-N-[4-(2,4-dimethoxyanilino)phenyl]benzamide |
|---|---|
| PubChem CID | 112987942 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-chloro-N-[4-(2,4-dimethoxyanilino)phenyl]benzamide |
| SMILES | COc1ccc(Nc2ccc(NC(=O)c3ccccc3Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H19ClN2O3/c1-26-16-11-12-19(20(13-16)27-2)23-14-7-9-15(10-8-14)24-21(25)17-5-3-4-6-18(17)22/h3-13,23H,1-2H3,(H,24,25) |
| InChIKey | GDFNVUYVUMVVHA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |