C29H22ClN3O5S2 — CID 99943737
4-(benzenesulfonamido)-2-chloro-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]benzamide (PubChem CID 99943737) has the molecular formula C29H22ClN3O5S2 and a molecular weight of 592.10 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-2-chloro-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-2-chloro-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 99943737 |
| Molecular Formula | C29H22ClN3O5S2 |
| Molecular Weight | 592.10 g/mol |
| Exact Mass | 591.07 |
| IUPAC Name | 4-(benzenesulfonamido)-2-chloro-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2cccc3ccccc23)cc1)c1ccc(NS(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C29H22ClN3O5S2/c30-27-19-22(32-39(35,36)23-9-2-1-3-10-23)15-18-26(27)29(34)31-21-13-16-24(17-14-21)40(37,38)33-28-12-6-8-20-7-4-5-11-25(20)28/h1-19,32-33H,(H,31,34) |
| InChIKey | RQYRXNUWZQTYBX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.10 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |