C30H28ClN3O4S — CID 43908153
4-(benzenesulfonamido)-N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-2-chlorobenzamide (PubChem CID 43908153) has the molecular formula C30H28ClN3O4S and a molecular weight of 562.09 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-2-chlorobenzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 43908153 |
| Molecular Formula | C30H28ClN3O4S |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[3-[(4-tert-butylbenzoyl)amino]phenyl]-2-chlorobenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(NC(=O)c3ccc(NS(=O)(=O)c4ccccc4)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C30H28ClN3O4S/c1-30(2,3)21-14-12-20(13-15-21)28(35)32-22-8-7-9-23(18-22)33-29(36)26-17-16-24(19-27(26)31)34-39(37,38)25-10-5-4-6-11-25/h4-19,34H,1-3H3,(H,32,35)(H,33,36) |
| InChIKey | SODHSRULZYSPBP-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |