C19H14Cl2N2O3S — CID 92674550
5-(benzenesulfonamido)-2-chloro-N-(3-chlorophenyl)benzamide (PubChem CID 92674550) has the molecular formula C19H14Cl2N2O3S and a molecular weight of 421.31 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-2-chloro-N-(3-chlorophenyl)benzamide.
| Compound Name | 5-(benzenesulfonamido)-2-chloro-N-(3-chlorophenyl)benzamide |
|---|---|
| PubChem CID | 92674550 |
| Molecular Formula | C19H14Cl2N2O3S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 5-(benzenesulfonamido)-2-chloro-N-(3-chlorophenyl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cc(NS(=O)(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C19H14Cl2N2O3S/c20-13-5-4-6-14(11-13)22-19(24)17-12-15(9-10-18(17)21)23-27(25,26)16-7-2-1-3-8-16/h1-12,23H,(H,22,24) |
| InChIKey | KFZJOWHNFHUZKV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |