C20H13Cl2F3N2O3S — CID 28634197
5-(benzenesulfonamido)-2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 28634197) has the molecular formula C20H13Cl2F3N2O3S and a molecular weight of 489.30 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 5-(benzenesulfonamido)-2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 28634197 |
| Molecular Formula | C20H13Cl2F3N2O3S |
| Molecular Weight | 489.30 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | 5-(benzenesulfonamido)-2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)c1cc(NS(=O)(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C20H13Cl2F3N2O3S/c21-17-8-7-13(27-31(29,30)14-4-2-1-3-5-14)10-15(17)19(28)26-12-6-9-18(22)16(11-12)20(23,24)25/h1-11,27H,(H,26,28) |
| InChIKey | CQGDWWCSPXBIDW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.30 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |