C15H11ClF3NO3S — CID 3712416
4-acetyl-N-[4-chloro-3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 3712416) has the molecular formula C15H11ClF3NO3S and a molecular weight of 377.77 g/mol. Its IUPAC name is 4-acetyl-N-[4-chloro-3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-acetyl-N-[4-chloro-3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3712416 |
| Molecular Formula | C15H11ClF3NO3S |
| Molecular Weight | 377.77 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 4-acetyl-N-[4-chloro-3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H11ClF3NO3S/c1-9(21)10-2-5-12(6-3-10)24(22,23)20-11-4-7-14(16)13(8-11)15(17,18)19/h2-8,20H,1H3 |
| InChIKey | WIUCRDUXPKFHQR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.77 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |