C20H14ClF3N2O3S — CID 92677411
4-(benzenesulfonamido)-2-chloro-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 92677411) has the molecular formula C20H14ClF3N2O3S and a molecular weight of 454.86 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-2-chloro-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-2-chloro-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 92677411 |
| Molecular Formula | C20H14ClF3N2O3S |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 4-(benzenesulfonamido)-2-chloro-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NS(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H14ClF3N2O3S/c21-18-12-15(26-30(28,29)16-4-2-1-3-5-16)10-11-17(18)19(27)25-14-8-6-13(7-9-14)20(22,23)24/h1-12,26H,(H,25,27) |
| InChIKey | NHBQBGHEVCWXTE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |