C28H24ClN3O4S — CID 46778797
N-[2-(benzylcarbamoyl)phenyl]-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 46778797) has the molecular formula C28H24ClN3O4S and a molecular weight of 534.04 g/mol. Its IUPAC name is N-[2-(benzylcarbamoyl)phenyl]-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[2-(benzylcarbamoyl)phenyl]-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 46778797 |
| Molecular Formula | C28H24ClN3O4S |
| Molecular Weight | 534.04 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | N-[2-(benzylcarbamoyl)phenyl]-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3ccccc3C(=O)NCc3ccccc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C28H24ClN3O4S/c1-19-11-14-22(15-12-19)37(35,36)32-21-13-16-23(25(29)17-21)28(34)31-26-10-6-5-9-24(26)27(33)30-18-20-7-3-2-4-8-20/h2-17,32H,18H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | TZLZFZDYHPXAAM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.04 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |