C20H16ClFN2O3S — CID 99956396
4-(benzenesulfonamido)-2-chloro-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 99956396) has the molecular formula C20H16ClFN2O3S and a molecular weight of 418.88 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-2-chloro-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-2-chloro-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 99956396 |
| Molecular Formula | C20H16ClFN2O3S |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 4-(benzenesulfonamido)-2-chloro-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc(NS(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H16ClFN2O3S/c21-19-12-16(24-28(26,27)17-4-2-1-3-5-17)10-11-18(19)20(25)23-13-14-6-8-15(22)9-7-14/h1-12,24H,13H2,(H,23,25) |
| InChIKey | OELDVNGUNIXZER-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |