C20H15ClF2N2O3S — CID 27163581
2-chloro-N-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)sulfamoyl]benzamide (PubChem CID 27163581) has the molecular formula C20H15ClF2N2O3S and a molecular weight of 436.87 g/mol. Its IUPAC name is 2-chloro-N-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | 2-chloro-N-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 27163581 |
| Molecular Formula | C20H15ClF2N2O3S |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-chloro-N-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)sulfamoyl]benzamide |
| SMILES | O=C(NCc1ccccc1F)c1cc(S(=O)(=O)Nc2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C20H15ClF2N2O3S/c21-18-10-9-16(29(27,28)25-15-7-5-14(22)6-8-15)11-17(18)20(26)24-12-13-3-1-2-4-19(13)23/h1-11,25H,12H2,(H,24,26) |
| InChIKey | PTKSBQULNCSWPF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |