C22H20Cl2N2O3S2 — CID 46762901
4-(benzenesulfonamido)-2-chloro-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 46762901) has the molecular formula C22H20Cl2N2O3S2 and a molecular weight of 495.45 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-2-chloro-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-2-chloro-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 46762901 |
| Molecular Formula | C22H20Cl2N2O3S2 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 4-(benzenesulfonamido)-2-chloro-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSCc1ccccc1Cl)c1ccc(NS(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C22H20Cl2N2O3S2/c23-20-9-5-4-6-16(20)15-30-13-12-25-22(27)19-11-10-17(14-21(19)24)26-31(28,29)18-7-2-1-3-8-18/h1-11,14,26H,12-13,15H2,(H,25,27) |
| InChIKey | QNYDZDJJCOLAIW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|