C20H25ClN2O3S2 — CID 30398696
N-(2-tert-butylsulfanylethyl)-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 30398696) has the molecular formula C20H25ClN2O3S2 and a molecular weight of 441.02 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 30398696 |
| Molecular Formula | C20H25ClN2O3S2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)NCCSC(C)(C)C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H25ClN2O3S2/c1-14-5-8-16(9-6-14)28(25,26)23-15-7-10-17(18(21)13-15)19(24)22-11-12-27-20(2,3)4/h5-10,13,23H,11-12H2,1-4H3,(H,22,24) |
| InChIKey | BCLDKUIWOSPIDN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|