C24H32ClN3O3S — CID 46778171
2-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 46778171) has the molecular formula C24H32ClN3O3S and a molecular weight of 478.06 g/mol. Its IUPAC name is 2-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | 2-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 46778171 |
| Molecular Formula | C24H32ClN3O3S |
| Molecular Weight | 478.06 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 2-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)NCCCN3CC(C)CC(C)C3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H32ClN3O3S/c1-17-5-8-21(9-6-17)32(30,31)27-20-7-10-22(23(25)14-20)24(29)26-11-4-12-28-15-18(2)13-19(3)16-28/h5-10,14,18-19,27H,4,11-13,15-16H2,1-3H3,(H,26,29) |
| InChIKey | QHNQUYVCZXMZQG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.06 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|