C19H30N2O — CID 100532484
N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-2,5-dimethylbenzamide (PubChem CID 100532484) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-2,5-dimethylbenzamide.
| Compound Name | N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 100532484 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)NCCCN2C[C@@H](C)C[C@H](C)C2)c1 |
| InChI | InChI=1S/C19H30N2O/c1-14-6-7-17(4)18(11-14)19(22)20-8-5-9-21-12-15(2)10-16(3)13-21/h6-7,11,15-16H,5,8-10,12-13H2,1-4H3,(H,20,22)/t15-,16-/m0/s1 |
| InChIKey | IVWZMULUGWZZCN-HOTGVXAUSA-N |
| XLogP | 3.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|