C24H31ClFN3O3S — CID 166180565
4-chloro-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[(4-fluorophenyl)sulfonylamino]benzamide (PubChem CID 166180565) has the molecular formula C24H31ClFN3O3S and a molecular weight of 496.05 g/mol. Its IUPAC name is 4-chloro-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[(4-fluorophenyl)sulfonylamino]benzamide.
| Compound Name | 4-chloro-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[(4-fluorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 166180565 |
| Molecular Formula | C24H31ClFN3O3S |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 4-chloro-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[(4-fluorophenyl)sulfonylamino]benzamide |
| SMILES | CC1CC(C)CN(CCCCNC(=O)c2ccc(Cl)c(NS(=O)(=O)c3ccc(F)cc3)c2)C1 |
| InChI | InChI=1S/C24H31ClFN3O3S/c1-17-13-18(2)16-29(15-17)12-4-3-11-27-24(30)19-5-10-22(25)23(14-19)28-33(31,32)21-8-6-20(26)7-9-21/h5-10,14,17-18,28H,3-4,11-13,15-16H2,1-2H3,(H,27,30) |
| InChIKey | WPIAUNZTIVLRLD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|