C26H37N3O4S — CID 55847760
N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[(4-ethoxyphenyl)sulfonylamino]benzamide (PubChem CID 55847760) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[(4-ethoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[(4-ethoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 55847760 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-[(4-ethoxyphenyl)sulfonylamino]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cccc(C(=O)NCCCCN3CC(C)CC(C)C3)c2)cc1 |
| InChI | InChI=1S/C26H37N3O4S/c1-4-33-24-10-12-25(13-11-24)34(31,32)28-23-9-7-8-22(17-23)26(30)27-14-5-6-15-29-18-20(2)16-21(3)19-29/h7-13,17,20-21,28H,4-6,14-16,18-19H2,1-3H3,(H,27,30) |
| InChIKey | WAJKTFUVTSDKHA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|