C24H37N3O2 — CID 55782171
3-(cyclohexanecarbonylamino)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzamide (PubChem CID 55782171) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is 3-(cyclohexanecarbonylamino)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 3-(cyclohexanecarbonylamino)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 55782171 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | 3-(cyclohexanecarbonylamino)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)c2cccc(NC(=O)C3CCCCC3)c2)C1 |
| InChI | InChI=1S/C24H37N3O2/c1-18-14-19(2)17-27(16-18)13-7-12-25-23(28)21-10-6-11-22(15-21)26-24(29)20-8-4-3-5-9-20/h6,10-11,15,18-20H,3-5,7-9,12-14,16-17H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | RWIAQDYXCCMHIZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|