C28H39N3OS — CID 100737360
1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]thiourea (PubChem CID 100737360) has the molecular formula C28H39N3OS and a molecular weight of 465.71 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 100737360 |
| Molecular Formula | C28H39N3OS |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCNC(=S)Nc2cccc(C(=O)c3ccc(C(C)(C)C)cc3)c2)C1 |
| InChI | InChI=1S/C28H39N3OS/c1-20-16-21(2)19-31(18-20)15-7-14-29-27(33)30-25-9-6-8-23(17-25)26(32)22-10-12-24(13-11-22)28(3,4)5/h6,8-13,17,20-21H,7,14-16,18-19H2,1-5H3,(H2,29,30,33)/t20-,21-/m1/s1 |
| InChIKey | FZQMESDUKQLBID-NHCUHLMSSA-N |
| XLogP | 5.87 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|