C29H33N3O2S — CID 100625557
1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(4-morpholin-4-ylphenyl)methyl]thiourea (PubChem CID 100625557) has the molecular formula C29H33N3O2S and a molecular weight of 487.67 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(4-morpholin-4-ylphenyl)methyl]thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(4-morpholin-4-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100625557 |
| Molecular Formula | C29H33N3O2S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(4-morpholin-4-ylphenyl)methyl]thiourea |
| SMILES | CC(C)(C)c1ccc(C(=O)c2cccc(NC(=S)NCc3ccc(N4CCOCC4)cc3)c2)cc1 |
| InChI | InChI=1S/C29H33N3O2S/c1-29(2,3)24-11-9-22(10-12-24)27(33)23-5-4-6-25(19-23)31-28(35)30-20-21-7-13-26(14-8-21)32-15-17-34-18-16-32/h4-14,19H,15-18,20H2,1-3H3,(H2,30,31,35) |
| InChIKey | PHVGCUBIQHWLCI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|