C27H25BrN4O2S — CID 100761046
1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-(4-tert-butylbenzoyl)phenyl]thiourea (PubChem CID 100761046) has the molecular formula C27H25BrN4O2S and a molecular weight of 549.49 g/mol. Its IUPAC name is 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-(4-tert-butylbenzoyl)phenyl]thiourea.
| Compound Name | 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-(4-tert-butylbenzoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100761046 |
| Molecular Formula | C27H25BrN4O2S |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-(4-tert-butylbenzoyl)phenyl]thiourea |
| SMILES | CC(C)(C)c1ccc(C(=O)c2cccc(NC(=S)NCc3nc(-c4cccc(Br)c4)no3)c2)cc1 |
| InChI | InChI=1S/C27H25BrN4O2S/c1-27(2,3)20-12-10-17(11-13-20)24(33)18-6-5-9-22(15-18)30-26(35)29-16-23-31-25(32-34-23)19-7-4-8-21(28)14-19/h4-15H,16H2,1-3H3,(H2,29,30,35) |
| InChIKey | UQKUNMKHCRFNPF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|