C17H15BrN4O2S — CID 100760836
1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(3-methoxyphenyl)thiourea (PubChem CID 100760836) has the molecular formula C17H15BrN4O2S and a molecular weight of 419.30 g/mol. Its IUPAC name is 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100760836 |
| Molecular Formula | C17H15BrN4O2S |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)NCc2nc(-c3cccc(Br)c3)no2)c1 |
| InChI | InChI=1S/C17H15BrN4O2S/c1-23-14-7-3-6-13(9-14)20-17(25)19-10-15-21-16(22-24-15)11-4-2-5-12(18)8-11/h2-9H,10H2,1H3,(H2,19,20,25) |
| InChIKey | SUUGBPZNWOKLPH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|