C17H14ClFN4O2S — CID 100760201
1-(3-chloro-4-fluorophenyl)-3-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea (PubChem CID 100760201) has the molecular formula C17H14ClFN4O2S and a molecular weight of 392.84 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100760201 |
| Molecular Formula | C17H14ClFN4O2S |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea |
| SMILES | COc1cccc(-c2noc(CNC(=S)Nc3ccc(F)c(Cl)c3)n2)c1 |
| InChI | InChI=1S/C17H14ClFN4O2S/c1-24-12-4-2-3-10(7-12)16-22-15(25-23-16)9-20-17(26)21-11-5-6-14(19)13(18)8-11/h2-8H,9H2,1H3,(H2,20,21,26) |
| InChIKey | RNPOABFNVJJXNF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|