C18H18N4O3S — CID 100758207
1-(3,4-dimethoxyphenyl)-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]thiourea (PubChem CID 100758207) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100758207 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]thiourea |
| SMILES | COc1ccc(NC(=S)NCc2nc(-c3ccccc3)no2)cc1OC |
| InChI | InChI=1S/C18H18N4O3S/c1-23-14-9-8-13(10-15(14)24-2)20-18(26)19-11-16-21-17(22-25-16)12-6-4-3-5-7-12/h3-10H,11H2,1-2H3,(H2,19,20,26) |
| InChIKey | CKZQZZROOQOQPG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|