C18H14BrClN4O3S — CID 100761000
methyl 5-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-2-chlorobenzoate (PubChem CID 100761000) has the molecular formula C18H14BrClN4O3S and a molecular weight of 481.76 g/mol. Its IUPAC name is methyl 5-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-2-chlorobenzoate.
| Compound Name | methyl 5-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 100761000 |
| Molecular Formula | C18H14BrClN4O3S |
| Molecular Weight | 481.76 g/mol |
| Exact Mass | 479.97 |
| IUPAC Name | methyl 5-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(NC(=S)NCc2nc(-c3cccc(Br)c3)no2)ccc1Cl |
| InChI | InChI=1S/C18H14BrClN4O3S/c1-26-17(25)13-8-12(5-6-14(13)20)22-18(28)21-9-15-23-16(24-27-15)10-3-2-4-11(19)7-10/h2-8H,9H2,1H3,(H2,21,22,28) |
| InChIKey | MIIPBMLAUWPHKM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.76 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|