C18H17BrN4OS — CID 100760783
1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 100760783) has the molecular formula C18H17BrN4OS and a molecular weight of 417.33 g/mol. Its IUPAC name is 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 100760783 |
| Molecular Formula | C18H17BrN4OS |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 1-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NCc2nc(-c3cccc(Br)c3)no2)c1 |
| InChI | InChI=1S/C18H17BrN4OS/c1-11-6-7-12(2)15(8-11)21-18(25)20-10-16-22-17(23-24-16)13-4-3-5-14(19)9-13/h3-9H,10H2,1-2H3,(H2,20,21,25) |
| InChIKey | GGGYEUJWUCTZKB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|