C16H14ClN5OS — CID 100762967
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-methyl-2-pyridinyl)thiourea (PubChem CID 100762967) has the molecular formula C16H14ClN5OS and a molecular weight of 359.84 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100762967 |
| Molecular Formula | C16H14ClN5OS |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1ccnc(NC(=S)NCc2nc(-c3cccc(Cl)c3)no2)c1 |
| InChI | InChI=1S/C16H14ClN5OS/c1-10-5-6-18-13(7-10)20-16(24)19-9-14-21-15(22-23-14)11-3-2-4-12(17)8-11/h2-8H,9H2,1H3,(H2,18,19,20,24) |
| InChIKey | SCWOPVWVRPTVJK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|