C17H14BrClN4OS — CID 100758627
1-(4-bromo-3-chlorophenyl)-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea (PubChem CID 100758627) has the molecular formula C17H14BrClN4OS and a molecular weight of 437.75 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100758627 |
| Molecular Formula | C17H14BrClN4OS |
| Molecular Weight | 437.75 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea |
| SMILES | Cc1cccc(-c2noc(CNC(=S)Nc3ccc(Br)c(Cl)c3)n2)c1 |
| InChI | InChI=1S/C17H14BrClN4OS/c1-10-3-2-4-11(7-10)16-22-15(24-23-16)9-20-17(25)21-12-5-6-13(18)14(19)8-12/h2-8H,9H2,1H3,(H2,20,21,25) |
| InChIKey | HTSKFBZMQHBHJX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.75 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|