C18H17BrN4O2S — CID 100760177
1-(4-bromo-3-methylphenyl)-3-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea (PubChem CID 100760177) has the molecular formula C18H17BrN4O2S and a molecular weight of 433.33 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100760177 |
| Molecular Formula | C18H17BrN4O2S |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea |
| SMILES | COc1cccc(-c2noc(CNC(=S)Nc3ccc(Br)c(C)c3)n2)c1 |
| InChI | InChI=1S/C18H17BrN4O2S/c1-11-8-13(6-7-15(11)19)21-18(26)20-10-16-22-17(23-25-16)12-4-3-5-14(9-12)24-2/h3-9H,10H2,1-2H3,(H2,20,21,26) |
| InChIKey | XDNZZYSZJDVSKL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|