C20H22N4O3S — CID 100760320
1-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-propan-2-yloxyphenyl)thiourea (PubChem CID 100760320) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-propan-2-yloxyphenyl)thiourea.
| Compound Name | 1-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-propan-2-yloxyphenyl)thiourea |
|---|---|
| PubChem CID | 100760320 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-propan-2-yloxyphenyl)thiourea |
| SMILES | COc1cccc(-c2noc(CNC(=S)Nc3ccc(OC(C)C)cc3)n2)c1 |
| InChI | InChI=1S/C20H22N4O3S/c1-13(2)26-16-9-7-15(8-10-16)22-20(28)21-12-18-23-19(24-27-18)14-5-4-6-17(11-14)25-3/h4-11,13H,12H2,1-3H3,(H2,21,22,28) |
| InChIKey | IAUFRPCLJVYIGT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|