C24H22N4OS2 — CID 100758586
1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100758586) has the molecular formula C24H22N4OS2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100758586 |
| Molecular Formula | C24H22N4OS2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | Cc1cccc(-c2noc(CNC(=S)Nc3ccc(CSc4ccccc4)cc3)n2)c1 |
| InChI | InChI=1S/C24H22N4OS2/c1-17-6-5-7-19(14-17)23-27-22(29-28-23)15-25-24(30)26-20-12-10-18(11-13-20)16-31-21-8-3-2-4-9-21/h2-14H,15-16H2,1H3,(H2,25,26,30) |
| InChIKey | HTMIWABPUXPKCR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|