C20H20N4O3S — CID 100758617
methyl 2-methyl-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]benzoate (PubChem CID 100758617) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is methyl 2-methyl-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]benzoate.
| Compound Name | methyl 2-methyl-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100758617 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | methyl 2-methyl-3-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NCc2nc(-c3cccc(C)c3)no2)c1C |
| InChI | InChI=1S/C20H20N4O3S/c1-12-6-4-7-14(10-12)18-23-17(27-24-18)11-21-20(28)22-16-9-5-8-15(13(16)2)19(25)26-3/h4-10H,11H2,1-3H3,(H2,21,22,28) |
| InChIKey | XBYVLOBTNWFUEN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|