C19H17ClN4O3S — CID 100759147
methyl 4-chloro-3-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]benzoate (PubChem CID 100759147) has the molecular formula C19H17ClN4O3S and a molecular weight of 416.89 g/mol. Its IUPAC name is methyl 4-chloro-3-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]benzoate.
| Compound Name | methyl 4-chloro-3-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100759147 |
| Molecular Formula | C19H17ClN4O3S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | methyl 4-chloro-3-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=S)NCc2nc(-c3ccc(C)cc3)no2)c1 |
| InChI | InChI=1S/C19H17ClN4O3S/c1-11-3-5-12(6-4-11)17-23-16(27-24-17)10-21-19(28)22-15-9-13(18(25)26-2)7-8-14(15)20/h3-9H,10H2,1-2H3,(H2,21,22,28) |
| InChIKey | YZVWEPBSOMMVDP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|