C20H19ClN4O3S — CID 100759940
ethyl 4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-3-methylbenzoate (PubChem CID 100759940) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is ethyl 4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-3-methylbenzoate.
| Compound Name | ethyl 4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 100759940 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | ethyl 4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NCc2nc(-c3ccc(Cl)cc3)no2)c(C)c1 |
| InChI | InChI=1S/C20H19ClN4O3S/c1-3-27-19(26)14-6-9-16(12(2)10-14)23-20(29)22-11-17-24-18(25-28-17)13-4-7-15(21)8-5-13/h4-10H,3,11H2,1-2H3,(H2,22,23,29) |
| InChIKey | PQTKMZLJTWLIQC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|