C22H24N4O4S — CID 100762427
ethyl 4-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-3-methylbenzoate (PubChem CID 100762427) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is ethyl 4-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-3-methylbenzoate.
| Compound Name | ethyl 4-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 100762427 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | ethyl 4-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylcarbamothioylamino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NCc2nc(-c3ccc(OCC)cc3)no2)c(C)c1 |
| InChI | InChI=1S/C22H24N4O4S/c1-4-28-17-9-6-15(7-10-17)20-25-19(30-26-20)13-23-22(31)24-18-11-8-16(12-14(18)3)21(27)29-5-2/h6-12H,4-5,13H2,1-3H3,(H2,23,24,31) |
| InChIKey | AFDIQGYZCGIMFP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 98.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|