C18H16F2N4O2S — CID 100762383
1-(3,4-difluorophenyl)-3-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea (PubChem CID 100762383) has the molecular formula C18H16F2N4O2S and a molecular weight of 390.42 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100762383 |
| Molecular Formula | C18H16F2N4O2S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]thiourea |
| SMILES | CCOc1ccc(-c2noc(CNC(=S)Nc3ccc(F)c(F)c3)n2)cc1 |
| InChI | InChI=1S/C18H16F2N4O2S/c1-2-25-13-6-3-11(4-7-13)17-23-16(26-24-17)10-21-18(27)22-12-5-8-14(19)15(20)9-12/h3-9H,2,10H2,1H3,(H2,21,22,27) |
| InChIKey | OTWPHKWMPPICCG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|