C19H21ClN2O2S — CID 100612062
methyl 4-chloro-3-[3-(4-methylphenyl)propylcarbamothioylamino]benzoate (PubChem CID 100612062) has the molecular formula C19H21ClN2O2S and a molecular weight of 376.91 g/mol. Its IUPAC name is methyl 4-chloro-3-[3-(4-methylphenyl)propylcarbamothioylamino]benzoate.
| Compound Name | methyl 4-chloro-3-[3-(4-methylphenyl)propylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100612062 |
| Molecular Formula | C19H21ClN2O2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | methyl 4-chloro-3-[3-(4-methylphenyl)propylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=S)NCCCc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C19H21ClN2O2S/c1-13-5-7-14(8-6-13)4-3-11-21-19(25)22-17-12-15(18(23)24-2)9-10-16(17)20/h5-10,12H,3-4,11H2,1-2H3,(H2,21,22,25) |
| InChIKey | YVCMZHPPBUBVCW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|