C21H25ClN4O2S — CID 100749245
methyl 4-chloro-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylcarbamothioylamino]benzoate (PubChem CID 100749245) has the molecular formula C21H25ClN4O2S and a molecular weight of 432.98 g/mol. Its IUPAC name is methyl 4-chloro-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylcarbamothioylamino]benzoate.
| Compound Name | methyl 4-chloro-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100749245 |
| Molecular Formula | C21H25ClN4O2S |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | methyl 4-chloro-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=S)NCc2ccc(N3CCN(C)CC3)cc2)c1 |
| InChI | InChI=1S/C21H25ClN4O2S/c1-25-9-11-26(12-10-25)17-6-3-15(4-7-17)14-23-21(29)24-19-13-16(20(27)28-2)5-8-18(19)22/h3-8,13H,9-12,14H2,1-2H3,(H2,23,24,29) |
| InChIKey | LEKRKBDYLOBYIK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|