C23H29N3O2S — CID 100724003
methyl 4-methyl-3-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methylcarbamothioylamino]benzoate (PubChem CID 100724003) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is methyl 4-methyl-3-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methylcarbamothioylamino]benzoate.
| Compound Name | methyl 4-methyl-3-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100724003 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | methyl 4-methyl-3-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=S)NCc2ccc(N3CCC[C@@H](C)C3)cc2)c1 |
| InChI | InChI=1S/C23H29N3O2S/c1-16-5-4-12-26(15-16)20-10-7-18(8-11-20)14-24-23(29)25-21-13-19(22(27)28-3)9-6-17(21)2/h6-11,13,16H,4-5,12,14-15H2,1-3H3,(H2,24,25,29)/t16-/m1/s1 |
| InChIKey | IOZXAPKQHOKUNB-MRXNPFEDSA-N |
| XLogP | 4.50 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|